CAS 1286793-01-8 is the registry number for 7-Bromo-3,3-difluoro-2,3-dihydro-5-methylindole-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
7-bromo-3,3-difluoro-5-methyl-1H-indol-2-one (CAS 1286793-01-8) is a chemical compound with the molecular formula C9H6BrF2NO and a molecular weight of 262.05 g/mol. IUPAC name: 7-bromo-3,3-difluoro-5-methyl-1H-indol-2-one. InChIKey: WWYISPNTRZNSCO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2NO |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 7-bromo-3,3-difluoro-5-methyl-1H-indol-2-one |
| InChIKey | WWYISPNTRZNSCO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)NC(=O)C2(F)F |
Computed by PubChem (NCBI)