Products 2605229-86-3
CAS 2605229-86-3 is the registry number for 7-Bromo-4,4-difluoro-1,4-dihydroisoquinolin-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4,4-difluoro-1,2-dihydroisoquinolin-3-one (CAS 2605229-86-3) is a chemical compound with the molecular formula C9H6BrF2NO and a molecular weight of 262.05 g/mol. IUPAC name: 7-bromo-4,4-difluoro-1,2-dihydroisoquinolin-3-one. InChIKey: MQGCOGLWYHZSTO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2NO |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 7-bromo-4,4-difluoro-1,2-dihydroisoquinolin-3-one |
| InChIKey | MQGCOGLWYHZSTO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(C(=O)N1)(F)F |
Computed by PubChem (NCBI)