CAS 2940944-82-9 is the registry number for 8-Bromo-4,4-difluoro-1,4-dihydroisoquinolin-3(2H)-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
8-bromo-4,4-difluoro-1,2-dihydroisoquinolin-3-one (CAS 2940944-82-9) is a chemical compound with the molecular formula C9H6BrF2NO and a molecular weight of 262.05 g/mol. IUPAC name: 8-bromo-4,4-difluoro-1,2-dihydroisoquinolin-3-one. InChIKey: PMAONAVGYFRMTG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2NO |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 8-bromo-4,4-difluoro-1,2-dihydroisoquinolin-3-one |
| InChIKey | PMAONAVGYFRMTG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)C(C(=O)N1)(F)F |
Computed by PubChem (NCBI)