Products 1553446-79-9
CAS 1553446-79-9 is the registry number for 3-Bromo-4-(2,2-difluoroethoxy)benzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-4-(2,2-difluoroethoxy)benzonitrile (CAS 1553446-79-9) is a chemical compound with the molecular formula C9H6BrF2NO and a molecular weight of 262.05 g/mol. IUPAC name: 3-bromo-4-(2,2-difluoroethoxy)benzonitrile. InChIKey: JZDYVYYKTFWUMV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF2NO |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 3-bromo-4-(2,2-difluoroethoxy)benzonitrile |
| InChIKey | JZDYVYYKTFWUMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Br)OCC(F)F |
Computed by PubChem (NCBI)