Products 1286887-71-5
CAS 1286887-71-5 is the registry number for (1-Methyl-5-bis(2’-hydroxyethyl)aminobenzimidazolyl-2)butanoic Acid Ethyl Ester-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Ethyl 4-[5-[bis(2-hydroxyethyl)amino]-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate (CAS 1286887-71-5) is a chemical compound with the molecular formula C18H27N3O4 and a molecular weight of 352.4 g/mol. IUPAC name: ethyl 4-[5-[bis(2-hydroxyethyl)amino]-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate. InChIKey: SJYOJVBTSZGDQH-BMSJAHLVSA-N.
| Molecular formula | C18H27N3O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | ethyl 4-[5-[bis(2-hydroxyethyl)amino]-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate |
| InChIKey | SJYOJVBTSZGDQH-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C=C(C=C2)N(CCO)CCO)N=C1CCCC(=O)OCC |
Computed by PubChem (NCBI)