Products 1932167-34-4

CAS 1932167-34-4 is the registry number for (S)-1-Benzyl 4-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-O-benzyl 4-O-tert-butyl (2S)-2-(aminomethyl)piperazine-1,4-dicarboxylate (CAS 1932167-34-4) is a chemical compound with the molecular formula C18H27N3O4 and a molecular weight of 349.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl (2S)-2-(aminomethyl)piperazine-1,4-dicarboxylate. InChIKey: UPAFWAIJOIWWEZ-HNNXBMFYSA-N.

Identity
Molecular formulaC18H27N3O4
Molecular weight349.4 g/mol
IUPAC name1-O-benzyl 4-O-tert-butyl (2S)-2-(aminomethyl)piperazine-1,4-dicarboxylate
InChIKeyUPAFWAIJOIWWEZ-HNNXBMFYSA-N
SMILESCC(C)(C)OC(=O)N1CCN([C@H](C1)CN)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)