CAS 168158-16-5 is the registry number for KB-R7785, 99.90%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 1 mg.
(2S,3R)-N-hydroxy-2-methyl-N'-[(1S)-2-(methylamino)-2-oxo-1-phenylethyl]-3-(2-methylpropyl)butanediamide (CAS 168158-16-5) is a chemical compound with the molecular formula C18H27N3O4 and a molecular weight of 349.4 g/mol. IUPAC name: (2S,3R)-N-hydroxy-2-methyl-N'-[(1S)-2-(methylamino)-2-oxo-1-phenylethyl]-3-(2-methylpropyl)butanediamide. InChIKey: OFCWIPGKPUJTDP-CFVMTHIKSA-N.
| Molecular formula | C18H27N3O4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2S,3R)-N-hydroxy-2-methyl-N'-[(1S)-2-(methylamino)-2-oxo-1-phenylethyl]-3-(2-methylpropyl)butanediamide |
| InChIKey | OFCWIPGKPUJTDP-CFVMTHIKSA-N |
| SMILES | C[C@@H]([C@@H](CC(C)C)C(=O)N[C@@H](C1=CC=CC=C1)C(=O)NC)C(=O)NO |
Computed by PubChem (NCBI)