CAS 1212316-00-1 appears in our catalog under these names: 1-Benzyl 4-tert-butyl (2R)-2-(aminomethyl)piperazine-1,4-dicarboxylate, 95%, (R)-1-Benzyl 4-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-O-benzyl 4-O-tert-butyl (2R)-2-(aminomethyl)piperazine-1,4-dicarboxylate (CAS 1212316-00-1) is a chemical compound with the molecular formula C18H27N3O4 and a molecular weight of 349.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl (2R)-2-(aminomethyl)piperazine-1,4-dicarboxylate. InChIKey: UPAFWAIJOIWWEZ-OAHLLOKOSA-N.
| Molecular formula | C18H27N3O4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl (2R)-2-(aminomethyl)piperazine-1,4-dicarboxylate |
| InChIKey | UPAFWAIJOIWWEZ-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)CN)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)