CAS 1202800-72-3 appears in our catalog under these names: 4-Benzyl 1-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate, 95%, 4-Benzyl 1-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate, 97%, 4-BENZYL 1-TERT-BUTYL 2-(AMINOMETHYL)PIPERAZINE-1,4-DICARBOXYLATE, 98%, 98%, 4-BENZYL 1-TERT-BUTYL 2-(AMINOMETHYL)PIPERAZINE-1,4-DICARBOXYLATE, 95%+. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 25g, 100mg.
4-O-benzyl 1-O-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate (CAS 1202800-72-3) is a chemical compound with the molecular formula C18H27N3O4 and a molecular weight of 349.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate. InChIKey: HCTLIWDKRMAKAI-UHFFFAOYSA-N.
| Molecular formula | C18H27N3O4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate |
| InChIKey | HCTLIWDKRMAKAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1CN)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)