CAS 1287128-99-7 is the registry number for (R)-Carisbamate-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 1 mg, 10 mg.
[(2R)-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-hydroxyethyl] carbamate (CAS 1287128-99-7) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: [(2R)-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-hydroxyethyl] carbamate. InChIKey: OLBWFRRUHYQABZ-FCDGGRDXSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | [(2R)-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-hydroxyethyl] carbamate |
| InChIKey | OLBWFRRUHYQABZ-FCDGGRDXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[C@H](COC(=O)N)O)Cl)[2H])[2H] |
Computed by PubChem (NCBI)