CAS 1287651-83-5 is the registry number for RD0392. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 10 mg, 100 mg, 5 mg.
(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1287651-83-5) is a chemical compound with the molecular formula C12H11NO3S2 and a molecular weight of 281.4 g/mol. IUPAC name: (5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: BLHXTUCOFJOMCR-POHAHGRESA-N.
| Molecular formula | C12H11NO3S2 |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | (5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | BLHXTUCOFJOMCR-POHAHGRESA-N |
| SMILES | CCOC1=C(C=CC(=C1)/C=C\2/C(=O)NC(=S)S2)O |
Computed by PubChem (NCBI)