CAS 1287670-53-4 is the registry number for 1-Methyl-4-nitro-1H-pyrazole-3-carbaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-methyl-4-nitropyrazole-3-carbaldehyde (CAS 1287670-53-4) is a chemical compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. IUPAC name: 1-methyl-4-nitropyrazole-3-carbaldehyde. InChIKey: LTDRJEUPCWOBPP-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O3 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 1-methyl-4-nitropyrazole-3-carbaldehyde |
| InChIKey | LTDRJEUPCWOBPP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)