CAS 1876473-45-8 is the registry number for 2–Fluoro–4–(pyrrolidino)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-fluoro-4-pyrrolidin-1-ylphenyl)boronic acid (CAS 1876473-45-8) is a chemical compound with the molecular formula C10H13BFNO2 and a molecular weight of 209.03 g/mol. IUPAC name: (2-fluoro-4-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: XOUUZKGNIDWGKG-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | (2-fluoro-4-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | XOUUZKGNIDWGKG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCCC2)F)(O)O |
Computed by PubChem (NCBI)