Products 128889-33-8
CAS 128889-33-8 is the registry number for TrkA-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-aminophenyl)-4-phenylquinazolin-6-amine (CAS 128889-33-8) is a chemical compound with the molecular formula C20H16N4 and a molecular weight of 312.4 g/mol. IUPAC name: 2-(4-aminophenyl)-4-phenylquinazolin-6-amine. InChIKey: FDVDXJBQIDLTID-UHFFFAOYSA-N.
| Molecular formula | C20H16N4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2-(4-aminophenyl)-4-phenylquinazolin-6-amine |
| InChIKey | FDVDXJBQIDLTID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=C2C=C(C=C3)N)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)