CAS 2218-94-2 appears in our catalog under these names: Nitron, 98%, Nitron/ 99%, Nitron, Nitron, 95% , Nitron, >98.0%(T). Offered by: Combi-blocks, Chemat, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 25g, 1g, 50G, 100g.
N,1,4-triphenyl-4-aza-1-azonia-2-azanidacyclopent-5-en-3-imine (CAS 2218-94-2) is a chemical compound with the molecular formula C20H16N4 and a molecular weight of 312.4 g/mol. IUPAC name: N,1,4-triphenyl-4-aza-1-azonia-2-azanidacyclopent-5-en-3-imine. InChIKey: CWGBFIRHYJNILV-UHFFFAOYSA-N.
| Molecular formula | C20H16N4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | N,1,4-triphenyl-4-aza-1-azonia-2-azanidacyclopent-5-en-3-imine |
| InChIKey | CWGBFIRHYJNILV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=C2[N-][N+](=CN2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)