CAS 851768-62-2 is the registry number for 1–Imino–1',3'–dihydro–1H–spiro(naphthalene–2,2'–perimidin)–8–amine. Offered by: GLPBio. Available pack sizes: 100mg.
8'-iminospiro[1,3-dihydroperimidine-2,7'-naphthalene]-1'-amine (CAS 851768-62-2) is a chemical compound with the molecular formula C20H16N4 and a molecular weight of 312.4 g/mol. IUPAC name: 8'-iminospiro[1,3-dihydroperimidine-2,7'-naphthalene]-1'-amine. InChIKey: CXGACCZEFCWAJN-UHFFFAOYSA-N.
| Molecular formula | C20H16N4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 8'-iminospiro[1,3-dihydroperimidine-2,7'-naphthalene]-1'-amine |
| InChIKey | CXGACCZEFCWAJN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=N)C3(C=C2)NC4=CC=CC5=C4C(=CC=C5)N3 |
Computed by PubChem (NCBI)