CAS 15702-72-4 is the registry number for Bis(2,2-bipyridyl)dichloro Osmium(II), 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
2-pyridin-2-ylpyridine (CAS 15702-72-4) is a chemical compound with the molecular formula C20H16N4 and a molecular weight of 312.4 g/mol. IUPAC name: 2-pyridin-2-ylpyridine. InChIKey: XLXJSJOICYRXSE-UHFFFAOYSA-N.
| Molecular formula | C20H16N4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2-pyridin-2-ylpyridine |
| InChIKey | XLXJSJOICYRXSE-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=CC=N2.C1=CC=NC(=C1)C2=CC=CC=N2 |
Computed by PubChem (NCBI)