Products 1289174-13-5

CAS 1289174-13-5 is the registry number for 4-Formyl-6-methylnicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-formyl-6-methylpyridine-3-carboxylic acid (CAS 1289174-13-5) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 4-formyl-6-methylpyridine-3-carboxylic acid. InChIKey: FRHTWDXILCYLED-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO3
Molecular weight165.15 g/mol
IUPAC name4-formyl-6-methylpyridine-3-carboxylic acid
InChIKeyFRHTWDXILCYLED-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=N1)C(=O)O)C=O

Computed by PubChem (NCBI)