CAS 1289194-27-9 is the registry number for Ethyl 3-bromoimidazo[2,1-b]thiazole-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylate (CAS 1289194-27-9) is a chemical compound with the molecular formula C8H7BrN2O2S and a molecular weight of 275.12 g/mol. IUPAC name: ethyl 3-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylate. InChIKey: MRNAYCMWUVMXEZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2S |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | ethyl 3-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylate |
| InChIKey | MRNAYCMWUVMXEZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=CSC2=N1)Br |
Computed by PubChem (NCBI)