CAS 13460-15-6 appears in our catalog under these names: 7-Bromo-3-methyl-4H-1,2,4-benzothiadiazine-1,1-dione, 95%, 7-Bromo-3-methyl-4H-1,2,4-benzothiadiazine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
7-bromo-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 13460-15-6) is a chemical compound with the molecular formula C8H7BrN2O2S and a molecular weight of 275.12 g/mol. IUPAC name: 7-bromo-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: BWHVDVMKHHHBDU-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2S |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 7-bromo-3-methyl-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | BWHVDVMKHHHBDU-UHFFFAOYSA-N |
| SMILES | CC1=NS(=O)(=O)C2=C(N1)C=CC(=C2)Br |
Computed by PubChem (NCBI)