CAS 1878327-03-7 appears in our catalog under these names: (4-Bromo-2-cyanophenyl)methanesulfonamide, 95%, (4-Bromo-2-cyanophenyl)methanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4-bromo-2-cyanophenyl)methanesulfonamide (CAS 1878327-03-7) is a chemical compound with the molecular formula C8H7BrN2O2S and a molecular weight of 275.12 g/mol. IUPAC name: (4-bromo-2-cyanophenyl)methanesulfonamide. InChIKey: XASIZNAJRDISJQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2S |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | (4-bromo-2-cyanophenyl)methanesulfonamide |
| InChIKey | XASIZNAJRDISJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C#N)CS(=O)(=O)N |
Computed by PubChem (NCBI)