CAS 92046-06-5 is the registry number for 5-(5-Bromothiophen-2-yl)-5-methylimidazolidine-2,4-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(5-bromothiophen-2-yl)-5-methylimidazolidine-2,4-dione (CAS 92046-06-5) is a chemical compound with the molecular formula C8H7BrN2O2S and a molecular weight of 275.12 g/mol. IUPAC name: 5-(5-bromothiophen-2-yl)-5-methylimidazolidine-2,4-dione. InChIKey: BWNAJTWFYYYMGM-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2S |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 5-(5-bromothiophen-2-yl)-5-methylimidazolidine-2,4-dione |
| InChIKey | BWNAJTWFYYYMGM-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)