Products 128941-84-4
CAS 128941-84-4 is the registry number for Vitamin K1 Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
(3E)-2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enylidene]naphthalene-1,4-dione (CAS 128941-84-4) is a chemical compound with the molecular formula C31H46O2 and a molecular weight of 450.7 g/mol. IUPAC name: (3E)-2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enylidene]naphthalene-1,4-dione. InChIKey: FGXMUHKTVYTDJE-UXGWLCKASA-N.
| Molecular formula | C31H46O2 |
|---|---|
| Molecular weight | 450.7 g/mol |
| IUPAC name | (3E)-2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enylidene]naphthalene-1,4-dione |
| InChIKey | FGXMUHKTVYTDJE-UXGWLCKASA-N |
| SMILES | CC1/C(=C\C=C(/C)\CCC[C@H](C)CCC[C@H](C)CCCC(C)C)/C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)
Synonyms:
Vitamin K1 Impurity 57, Vitamin K1 Impurity 145