CAS 16033-41-3 appears in our catalog under these names: cis-Vitamin K1, cis-Vitamin K1 (Z-Phytonadione), cis-Vitamin K1, >95% (HPLC), cis–Vitamin K1, Phytonadione Impurity 21. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg, 25mg, 1 mg, 50mg.
2-methyl-3-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione (CAS 16033-41-3) is a chemical compound with the molecular formula C31H46O2 and a molecular weight of 450.7 g/mol. IUPAC name: 2-methyl-3-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione. InChIKey: MBWXNTAXLNYFJB-ODDKJFTJSA-N.
| Molecular formula | C31H46O2 |
|---|---|
| Molecular weight | 450.7 g/mol |
| IUPAC name | 2-methyl-3-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione |
| InChIKey | MBWXNTAXLNYFJB-ODDKJFTJSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(/C)\CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
Computed by PubChem (NCBI)