CAS 132487-94-6 appears in our catalog under these names: Vitamin K1 Impurity 13, Vitamin K1 Impurity 121, Phytonadione Impurity 36, Phytonadione Trans-IV. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-methyl-3-[(E,7S,11S)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione (CAS 132487-94-6) is a chemical compound with the molecular formula C31H46O2 and a molecular weight of 450.7 g/mol. IUPAC name: 2-methyl-3-[(E,7S,11S)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione. InChIKey: MBWXNTAXLNYFJB-JHBCSKSVSA-N.
| Molecular formula | C31H46O2 |
|---|---|
| Molecular weight | 450.7 g/mol |
| IUPAC name | 2-methyl-3-[(E,7S,11S)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione |
| InChIKey | MBWXNTAXLNYFJB-JHBCSKSVSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C |
Computed by PubChem (NCBI)