Products 79083-00-4

CAS 79083-00-4 is the registry number for Vitamin K1-18O(Mixture of 1-18O and 4-18O). Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione (CAS 79083-00-4) is a chemical compound with the molecular formula C31H46O2 and a molecular weight of 450.7 g/mol. IUPAC name: 2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione. InChIKey: MBWXNTAXLNYFJB-NKFFZRIASA-N.

Identity
Molecular formulaC31H46O2
Molecular weight450.7 g/mol
IUPAC name2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione
InChIKeyMBWXNTAXLNYFJB-NKFFZRIASA-N
SMILESCC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C

Computed by PubChem (NCBI)