Products 1290935-89-5
CAS 1290935-89-5 is the registry number for 1-(3-Iodobenzoyl)pyrrolidine-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-iodobenzoyl)pyrrolidine-2-carboxamide (CAS 1290935-89-5) is a chemical compound with the molecular formula C12H13IN2O2 and a molecular weight of 344.15 g/mol. IUPAC name: 1-(3-iodobenzoyl)pyrrolidine-2-carboxamide. InChIKey: DENLELDYKVGUJP-UHFFFAOYSA-N.
| Molecular formula | C12H13IN2O2 |
|---|---|
| Molecular weight | 344.15 g/mol |
| IUPAC name | 1-(3-iodobenzoyl)pyrrolidine-2-carboxamide |
| InChIKey | DENLELDYKVGUJP-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2=CC(=CC=C2)I)C(=O)N |
Computed by PubChem (NCBI)