CAS 290368-00-2 appears in our catalog under these names: 1-Boc-3-iodoindazole 98%, Tert-Butyl 3-Iodo-1H-Indazole-1-Carboxylate, 98%, 98%, 1-Boc-3-Iodo-1H-indazole, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl 3-iodoindazole-1-carboxylate (CAS 290368-00-2) is a chemical compound with the molecular formula C12H13IN2O2 and a molecular weight of 344.15 g/mol. IUPAC name: tert-butyl 3-iodoindazole-1-carboxylate. InChIKey: DHNSGIOEVGLLOI-UHFFFAOYSA-N.
| Molecular formula | C12H13IN2O2 |
|---|---|
| Molecular weight | 344.15 g/mol |
| IUPAC name | tert-butyl 3-iodoindazole-1-carboxylate |
| InChIKey | DHNSGIOEVGLLOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2C(=N1)I |
Computed by PubChem (NCBI)