CAS 192189-18-7 appears in our catalog under these names: 1-Boc-3-Iodo-7-azaindole, 96%, tert-Butyl 3-iodo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate 95%, tert-Butyl 3-iodo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, 95%, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
Tert-butyl 3-iodopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 192189-18-7) is a chemical compound with the molecular formula C12H13IN2O2 and a molecular weight of 344.15 g/mol. IUPAC name: tert-butyl 3-iodopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: YNWXYUIDHAWPLF-UHFFFAOYSA-N.
| Molecular formula | C12H13IN2O2 |
|---|---|
| Molecular weight | 344.15 g/mol |
| IUPAC name | tert-butyl 3-iodopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | YNWXYUIDHAWPLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1N=CC=C2)I |
Computed by PubChem (NCBI)