CAS 705262-62-0 appears in our catalog under these names: tert-Butyl 5-iodo-1H-benzo[d]imidazole-1-carboxylate 95+%, tert-Butyl 5-iodo-1H-benzo[d]imidazole-1-carboxylate, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 5-iodobenzimidazole-1-carboxylate (CAS 705262-62-0) is a chemical compound with the molecular formula C12H13IN2O2 and a molecular weight of 344.15 g/mol. IUPAC name: tert-butyl 5-iodobenzimidazole-1-carboxylate. InChIKey: JCLOZQWFPPQKMX-UHFFFAOYSA-N.
| Molecular formula | C12H13IN2O2 |
|---|---|
| Molecular weight | 344.15 g/mol |
| IUPAC name | tert-butyl 5-iodobenzimidazole-1-carboxylate |
| InChIKey | JCLOZQWFPPQKMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=NC2=C1C=CC(=C2)I |
Computed by PubChem (NCBI)