CAS 1291831-59-8 is the registry number for N-[(4,7-Dimethoxy-1h-indol-2-yl)carbonyl]-l-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoic acid (CAS 1291831-59-8) is a chemical compound with the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. IUPAC name: (2S)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoic acid. InChIKey: VUAHMLVEMBXQRZ-ZETCQYMHSA-N.
| Molecular formula | C14H16N2O5 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | (2S)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoic acid |
| InChIKey | VUAHMLVEMBXQRZ-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)C1=CC2=C(C=CC(=C2N1)OC)OC |
Computed by PubChem (NCBI)