Products 1803588-79-5
CAS 1803588-79-5 appears in our catalog under these names: 1-[1-(2-Aminoethyl)-1h-indol-3-yl]ethan-1-one oxalic acid, 95%, 1-(1-(2-Aminoethyl)-1H-indol-3-yl)ethanone oxalate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg.
1-[1-(2-aminoethyl)indol-3-yl]ethanone;oxalic acid (CAS 1803588-79-5) is a chemical compound with the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. IUPAC name: 1-[1-(2-aminoethyl)indol-3-yl]ethanone;oxalic acid. InChIKey: BENORIROIGNVPJ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 1-[1-(2-aminoethyl)indol-3-yl]ethanone;oxalic acid |
| InChIKey | BENORIROIGNVPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN(C2=CC=CC=C21)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)