CAS 914349-07-8 appears in our catalog under these names: 1-Boc-3-hydroxymethyl-5-nitroindole, 96%, tert-Butyl 3-(hydroxymethyl)-5-nitro-1H-indole-1-carboxylate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg.
Tert-butyl 3-(hydroxymethyl)-5-nitroindole-1-carboxylate (CAS 914349-07-8) is a chemical compound with the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. IUPAC name: tert-butyl 3-(hydroxymethyl)-5-nitroindole-1-carboxylate. InChIKey: ZMPACHXTNKWGMG-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | tert-butyl 3-(hydroxymethyl)-5-nitroindole-1-carboxylate |
| InChIKey | ZMPACHXTNKWGMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)