CAS 878259-64-4 appears in our catalog under these names: 4-(6,7-Dimethoxy-4-oxoquinazolin-3(4h)-yl)butanoic acid, 95%, 4-(6,7-Dimethoxy-4-oxo-3,4-dihydroquinazolin-3-yl)butanoic acid, 4-(6,7-Dimethoxy-4-oxo-3,4-dihydroquinazolin-3-yl)butanoic acid, 95%. Offered by: Combi-blocks, Biosynth, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoic acid (CAS 878259-64-4) is a chemical compound with the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. IUPAC name: 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoic acid. InChIKey: KZQSTSRWNBBLFH-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanoic acid |
| InChIKey | KZQSTSRWNBBLFH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)N(C=N2)CCCC(=O)O)OC |
Computed by PubChem (NCBI)