CAS 129199-44-6 appears in our catalog under these names: 2-(2,4-Dichlorophenoxy)-3-nitropyridine, 95%, 2-(2,4-Dichlorophenoxy)-3-nitropyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(2,4-dichlorophenoxy)-3-nitropyridine (CAS 129199-44-6) is a chemical compound with the molecular formula C11H6Cl2N2O3 and a molecular weight of 285.08 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-3-nitropyridine. InChIKey: RBDZTSGZRDNTHV-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2O3 |
|---|---|
| Molecular weight | 285.08 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-3-nitropyridine |
| InChIKey | RBDZTSGZRDNTHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=C(C=C(C=C2)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)