CAS 869634-06-0 appears in our catalog under these names: 2-(4,5-Dichloro-6-oxopyridazin-1(6h)-yl)benzoic acid, 95%, 2-(4,5-Dichloro-6-oxo-1,6-dihydropyridazin-1-yl)benzoic acid, 98%, 2-(4,5-dichloro-6-oxo-1,6-dihydropyridazin-1-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 5g, 1g, 240mg, 250mg, 2,5g.
2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid (CAS 869634-06-0) is a chemical compound with the molecular formula C11H6Cl2N2O3 and a molecular weight of 285.08 g/mol. IUPAC name: 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid. InChIKey: FRCKNSHCQMCDBN-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2O3 |
|---|---|
| Molecular weight | 285.08 g/mol |
| IUPAC name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid |
| InChIKey | FRCKNSHCQMCDBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N2C(=O)C(=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)