CAS 25935-29-9 is the registry number for 2-(3,4-Dichlorophenoxy)-5-nitropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3,4-dichlorophenoxy)-5-nitropyridine (CAS 25935-29-9) is a chemical compound with the molecular formula C11H6Cl2N2O3 and a molecular weight of 285.08 g/mol. IUPAC name: 2-(3,4-dichlorophenoxy)-5-nitropyridine. InChIKey: MIKDIAAVUSISDM-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2O3 |
|---|---|
| Molecular weight | 285.08 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)-5-nitropyridine |
| InChIKey | MIKDIAAVUSISDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=NC=C(C=C2)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)