CAS 501649-79-2 appears in our catalog under these names: 3-(4,5-Dichloro-6-oxopyridazin-1(6h)-yl)benzoic acid, 95%, 3-(4,5-Dichloro-6-oxopyridazin-1(6H)-yl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
3-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid (CAS 501649-79-2) is a chemical compound with the molecular formula C11H6Cl2N2O3 and a molecular weight of 285.08 g/mol. IUPAC name: 3-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid. InChIKey: UCDIWDQNHGPZLN-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2O3 |
|---|---|
| Molecular weight | 285.08 g/mol |
| IUPAC name | 3-(4,5-dichloro-6-oxopyridazin-1-yl)benzoic acid |
| InChIKey | UCDIWDQNHGPZLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=O)C(=C(C=N2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)