Products 1292285-16-5
CAS 1292285-16-5 is the registry number for 9-(3-Bromophenyl)-9-(3-methylphenyl)-9H-fluorene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
9-(3-bromophenyl)-9-(3-methylphenyl)fluorene (CAS 1292285-16-5) is a chemical compound with the molecular formula C26H19Br and a molecular weight of 411.3 g/mol. IUPAC name: 9-(3-bromophenyl)-9-(3-methylphenyl)fluorene. InChIKey: XQYGCWSZCDHROU-UHFFFAOYSA-N.
| Molecular formula | C26H19Br |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 9-(3-bromophenyl)-9-(3-methylphenyl)fluorene |
| InChIKey | XQYGCWSZCDHROU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC(=CC=C5)Br |
Computed by PubChem (NCBI)