Products 1400890-62-1
CAS 1400890-62-1 appears in our catalog under these names: (2-(3-Bromophenyl)ethene-1,1,2-triyl)tribenzene, 98%, 98%, (2-(3-Bromophenyl)ethene-1,1,2-triyl)tribenzene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3-(1,2,2-triphenylethenyl)benzene (CAS 1400890-62-1) is a chemical compound with the molecular formula C26H19Br and a molecular weight of 411.3 g/mol. IUPAC name: 1-bromo-3-(1,2,2-triphenylethenyl)benzene. InChIKey: NBGYCGNBWNHVBV-UHFFFAOYSA-N.
| Molecular formula | C26H19Br |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 1-bromo-3-(1,2,2-triphenylethenyl)benzene |
| InChIKey | NBGYCGNBWNHVBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC(=CC=C3)Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)