CAS 3083012-31-8 is the registry number for 2-Bromo-5-methyl-9,9-diphenyl-9H-fluorene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-5-methyl-9,9-diphenylfluorene (CAS 3083012-31-8) is a chemical compound with the molecular formula C26H19Br and a molecular weight of 411.3 g/mol. IUPAC name: 2-bromo-5-methyl-9,9-diphenylfluorene. InChIKey: UMDDGYRHOFZLAU-UHFFFAOYSA-N.
| Molecular formula | C26H19Br |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 2-bromo-5-methyl-9,9-diphenylfluorene |
| InChIKey | UMDDGYRHOFZLAU-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(C=C(C=C3)Br)C(C2=CC=C1)(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)