CAS 34699-28-0 appears in our catalog under these names: 1-(4-Bromophenyl)-1,2,2-triphenylethene, 95-<97%, 1-(4-Bromophenyl)-1,2,2-triphenylethene, ≥97-<99%, 1-(4-Bromophenyl)-1,2,2-triphenylethylene, >98.0%(GC), 1-(4-Bromophenyl)-1,2,2-triphenylethylene 98%, 1-Bromo-4-(1,2,2-triphenylethenyl)benzene, 98%, 98%. Offered by: Hoffman Fine Chemicals, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 1g, 5g.
1-bromo-4-(1,2,2-triphenylethenyl)benzene (CAS 34699-28-0) is a chemical compound with the molecular formula C26H19Br and a molecular weight of 411.3 g/mol. IUPAC name: 1-bromo-4-(1,2,2-triphenylethenyl)benzene. InChIKey: MYJLJYSALGARCM-UHFFFAOYSA-N.
| Molecular formula | C26H19Br |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 1-bromo-4-(1,2,2-triphenylethenyl)benzene |
| InChIKey | MYJLJYSALGARCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)