Products 1292837-95-6
CAS 1292837-95-6 appears in our catalog under these names: Tranexamic Acid-13C2,15N, >95% (HPLC), Tranexamic Acid-13C2,15N, 98% 98%atom%13C,98%atom%15N, Tranexamic Acid–13C2,15N, Tranexamic acid-13C2,15N. Offered by: TRC, Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, on request, 5mg, 25mg, 50mg, 1 mg.
4-((15N)azanyl(113C)methyl)cyclohexane-1-carboxylic acid (CAS 1292837-95-6) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 160.19 g/mol. IUPAC name: 4-((15N)azanyl(113C)methyl)cyclohexane-1-carboxylic acid. InChIKey: GYDJEQRTZSCIOI-XGOBPNGOSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 160.19 g/mol |
| IUPAC name | 4-((15N)azanyl(113C)methyl)cyclohexane-1-carboxylic acid |
| InChIKey | GYDJEQRTZSCIOI-XGOBPNGOSA-N |
| SMILES | C1CC(CCC1[13CH2][15NH2])[13C](=O)O |
Computed by PubChem (NCBI)