Products 2714435-89-7
CAS 2714435-89-7 appears in our catalog under these names: Tranexamic-d2 Acid, >95% (HPLC), Tranexamic-d2 Acid (aminomethyl-d2), 98 atom % D, min 98% Chemical Purity, Tranexamic acid–d2–1, Tranexamic acid-d2-1, 99.19%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 500μg, 1mg, 500 μg, 1 mg.
4-[amino(dideuterio)methyl]cyclohexane-1-carboxylic acid (CAS 2714435-89-7) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 159.22 g/mol. IUPAC name: 4-[amino(dideuterio)methyl]cyclohexane-1-carboxylic acid. InChIKey: GYDJEQRTZSCIOI-BFWBPSQCSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 159.22 g/mol |
| IUPAC name | 4-[amino(dideuterio)methyl]cyclohexane-1-carboxylic acid |
| InChIKey | GYDJEQRTZSCIOI-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C1CCC(CC1)C(=O)O)N |
Computed by PubChem (NCBI)