Products 1557000-06-2
CAS 1557000-06-2 is the registry number for cis-Tranexamic acid-13C2,15N. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-((15N)azanyl(113C)methyl)cyclohexane-1-carboxylic acid (CAS 1557000-06-2) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 160.19 g/mol. IUPAC name: 4-((15N)azanyl(113C)methyl)cyclohexane-1-carboxylic acid. InChIKey: GYDJEQRTZSCIOI-XGOBPNGOSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 160.19 g/mol |
| IUPAC name | 4-((15N)azanyl(113C)methyl)cyclohexane-1-carboxylic acid |
| InChIKey | GYDJEQRTZSCIOI-XGOBPNGOSA-N |
| SMILES | C1CC(CCC1[13CH2][15NH2])[13C](=O)O |
Computed by PubChem (NCBI)