CAS 1292905-33-9 is the registry number for 3-((1R)-3-Hydroxy-1-phenyl-propyl)-4-hydroxy-benzoic acid methyl ester. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
Methyl 4-hydroxy-3-[(1R)-3-hydroxy-1-phenylpropyl]benzoate (CAS 1292905-33-9) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: methyl 4-hydroxy-3-[(1R)-3-hydroxy-1-phenylpropyl]benzoate. InChIKey: MWYMQEBIZZHNHO-CQSZACIVSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | methyl 4-hydroxy-3-[(1R)-3-hydroxy-1-phenylpropyl]benzoate |
| InChIKey | MWYMQEBIZZHNHO-CQSZACIVSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)O)[C@H](CCO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)