Products 129299-72-5
CAS 129299-72-5 is the registry number for (±)-Fabesetron. Offered by: MedChemExpress. Available pack sizes: Get quote.
10-methyl-7-[(5-methyl-1H-imidazol-4-yl)methyl]-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one (CAS 129299-72-5) is a chemical compound with the molecular formula C18H19N3O and a molecular weight of 293.4 g/mol. IUPAC name: 10-methyl-7-[(5-methyl-1H-imidazol-4-yl)methyl]-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one. InChIKey: AEKQMJRJRAHOAP-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 10-methyl-7-[(5-methyl-1H-imidazol-4-yl)methyl]-8,9-dihydro-7H-pyrido[1,2-a]indol-6-one |
| InChIKey | AEKQMJRJRAHOAP-UHFFFAOYSA-N |
| SMILES | CC1=C2CCC(C(=O)N2C3=CC=CC=C13)CC4=C(NC=N4)C |
Computed by PubChem (NCBI)