CAS 129369-64-8 appears in our catalog under these names: Irtemazole/ 98%, IRTEMAZOLE. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
6-[imidazol-1-yl(phenyl)methyl]-2-methyl-1H-benzimidazole (CAS 129369-64-8) is a chemical compound with the molecular formula C18H16N4 and a molecular weight of 288.3 g/mol. IUPAC name: 6-[imidazol-1-yl(phenyl)methyl]-2-methyl-1H-benzimidazole. InChIKey: DCGOMTSIZLGUOK-UHFFFAOYSA-N.
| Molecular formula | C18H16N4 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 6-[imidazol-1-yl(phenyl)methyl]-2-methyl-1H-benzimidazole |
| InChIKey | DCGOMTSIZLGUOK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)C(C3=CC=CC=C3)N4C=CN=C4 |
Computed by PubChem (NCBI)