CAS 54668-92-7 is the registry number for 3,7-Diamino-5-phenyl-5,10-dihydrophenazine. Offered by: TRC. Available pack sizes: 100mg.
10-phenyl-5H-phenazine-2,8-diamine (CAS 54668-92-7) is a chemical compound with the molecular formula C18H16N4 and a molecular weight of 288.3 g/mol. IUPAC name: 10-phenyl-5H-phenazine-2,8-diamine. InChIKey: OEFOERUJDNEVQU-UHFFFAOYSA-N.
| Molecular formula | C18H16N4 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 10-phenyl-5H-phenazine-2,8-diamine |
| InChIKey | OEFOERUJDNEVQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=CC(=C3)N)NC4=C2C=C(C=C4)N |
Computed by PubChem (NCBI)