Products 199596-07-1
CAS 199596-07-1 is the registry number for (E)-5-Methyl-2-(2-(phenyl(pyridin-2-yl)methylene)hydrazinyl)pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine (CAS 199596-07-1) is a chemical compound with the molecular formula C18H16N4 and a molecular weight of 288.3 g/mol. IUPAC name: 5-methyl-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine. InChIKey: XTQFGOVMCQYQFP-RELWKKBWSA-N.
| Molecular formula | C18H16N4 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 5-methyl-N-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]pyridin-2-amine |
| InChIKey | XTQFGOVMCQYQFP-RELWKKBWSA-N |
| SMILES | CC1=CN=C(C=C1)N/N=C(\C2=CC=CC=C2)/C3=CC=CC=N3 |
Computed by PubChem (NCBI)